Products 349403-79-8
CAS 349403-79-8 is the registry number for 4-chloro-N-cyclopentylbenzenesulfonamide, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
4-chloro-N-cyclopentylbenzenesulfonamide (CAS 349403-79-8) is a chemical compound with the molecular formula C11H14ClNO2S and a molecular weight of 259.75 g/mol. IUPAC name: 4-chloro-N-cyclopentylbenzenesulfonamide. InChIKey: TZIJEZNCKUQLPW-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2S |
|---|---|
| Molecular weight | 259.75 g/mol |
| IUPAC name | 4-chloro-N-cyclopentylbenzenesulfonamide |
| InChIKey | TZIJEZNCKUQLPW-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NS(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)