Products 1156269-60-1

CAS 1156269-60-1 is the registry number for 1-((5-Chlorothiophen-2-yl)methyl)piperidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-[(5-chlorothiophen-2-yl)methyl]piperidine-4-carboxylic acid (CAS 1156269-60-1) is a chemical compound with the molecular formula C11H14ClNO2S and a molecular weight of 259.75 g/mol. IUPAC name: 1-[(5-chlorothiophen-2-yl)methyl]piperidine-4-carboxylic acid. InChIKey: CQTOEYZFHGTGIF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14ClNO2S
Molecular weight259.75 g/mol
IUPAC name1-[(5-chlorothiophen-2-yl)methyl]piperidine-4-carboxylic acid
InChIKeyCQTOEYZFHGTGIF-UHFFFAOYSA-N
SMILESC1CN(CCC1C(=O)O)CC2=CC=C(S2)Cl

Computed by PubChem (NCBI)