Products 727989-58-4

CAS 727989-58-4 is the registry number for 4-Phenylpiperidine-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,05g, 0,1g, 0,25g, 0,5g, 1g.

Structural formula: {0} (CAS {1})

4-phenylpiperidine-1-sulfonyl chloride (CAS 727989-58-4) is a chemical compound with the molecular formula C11H14ClNO2S and a molecular weight of 259.75 g/mol. IUPAC name: 4-phenylpiperidine-1-sulfonyl chloride. InChIKey: YHRJYALJKYVQCE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14ClNO2S
Molecular weight259.75 g/mol
IUPAC name4-phenylpiperidine-1-sulfonyl chloride
InChIKeyYHRJYALJKYVQCE-UHFFFAOYSA-N
SMILESC1CN(CCC1C2=CC=CC=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)