CAS 1052063-36-1 appears in our catalog under these names: (3R,4R,5S)-4-(Acetylamino)-5-amino-3-(1-methylethoxy)-1-Cyclohexene-1-carboxylic Acid Ethyl Ester, Oseltamivir Impurity 54. Offered by: TRC, Chemat Brand. Available pack sizes: 25mg, on request.
Ethyl (3R,4R,5S)-4-acetamido-5-amino-3-propan-2-yloxycyclohexene-1-carboxylate (CAS 1052063-36-1) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: ethyl (3R,4R,5S)-4-acetamido-5-amino-3-propan-2-yloxycyclohexene-1-carboxylate. InChIKey: LYFBTGLCZFIQTP-YNEHKIRRSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | ethyl (3R,4R,5S)-4-acetamido-5-amino-3-propan-2-yloxycyclohexene-1-carboxylate |
| InChIKey | LYFBTGLCZFIQTP-YNEHKIRRSA-N |
| SMILES | CCOC(=O)C1=C[C@H]([C@@H]([C@H](C1)N)NC(=O)C)OC(C)C |
Computed by PubChem (NCBI)