CAS 105208-35-3 is the registry number for N2,N2-Dimethylamino-6-deamino adenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,4S,5R)-2-[2-(dimethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (CAS 105208-35-3) is a chemical compound with the molecular formula C12H17N5O4 and a molecular weight of 295.29 g/mol. IUPAC name: (2R,3R,4S,5R)-2-[2-(dimethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: LATGTARLJMDFKA-TURQNECASA-N.
| Molecular formula | C12H17N5O4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-[2-(dimethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | LATGTARLJMDFKA-TURQNECASA-N |
| SMILES | CN(C)C1=NC=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)