Products 142997-59-9
CAS 142997-59-9 appears in our catalog under these names: 1-Hydroxyethyl-2'-deoxyadenosine, 1-Hydroxyethyl-2′-deoxyadenosine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg, Get quote.
(2R,3R,5R)-5-[1-(2-hydroxyethyl)-6-iminopurin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (CAS 142997-59-9) is a chemical compound with the molecular formula C12H17N5O4 and a molecular weight of 295.29 g/mol. IUPAC name: (2R,3R,5R)-5-[1-(2-hydroxyethyl)-6-iminopurin-9-yl]-2-(hydroxymethyl)oxolan-3-ol. InChIKey: CFZWOQIYPJCTQP-IWSPIJDZSA-N.
| Molecular formula | C12H17N5O4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | (2R,3R,5R)-5-[1-(2-hydroxyethyl)-6-iminopurin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | CFZWOQIYPJCTQP-IWSPIJDZSA-N |
| SMILES | C1[C@H]([C@H](O[C@H]1N2C=NC3=C2N=CN(C3=N)CCO)CO)O |
Computed by PubChem (NCBI)