CAS 10524-81-9 is the registry number for N-(2,4-Dichloro-6-methylphenyl)thiourea, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2,4-dichloro-6-methylphenyl)thiourea (CAS 10524-81-9) is a chemical compound with the molecular formula C8H8Cl2N2S and a molecular weight of 235.13 g/mol. IUPAC name: (2,4-dichloro-6-methylphenyl)thiourea. InChIKey: VNDOLXOJGVRXCZ-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2S |
|---|---|
| Molecular weight | 235.13 g/mol |
| IUPAC name | (2,4-dichloro-6-methylphenyl)thiourea |
| InChIKey | VNDOLXOJGVRXCZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=S)N)Cl)Cl |
Computed by PubChem (NCBI)