CAS 1559059-95-8 is the registry number for 5-Chloro-6-methyl-1,3-benzothiazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-chloro-6-methyl-1,3-benzothiazol-2-amine;hydrochloride (CAS 1559059-95-8) is a chemical compound with the molecular formula C8H8Cl2N2S and a molecular weight of 235.13 g/mol. IUPAC name: 5-chloro-6-methyl-1,3-benzothiazol-2-amine;hydrochloride. InChIKey: WNGWNECEKNWDBV-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2S |
|---|---|
| Molecular weight | 235.13 g/mol |
| IUPAC name | 5-chloro-6-methyl-1,3-benzothiazol-2-amine;hydrochloride |
| InChIKey | WNGWNECEKNWDBV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)N=C(S2)N.Cl |
Computed by PubChem (NCBI)