CAS 2893971-20-3 is the registry number for 1,4-Dichloro-5,5-dimethyl-5,7-dihydrothieno[3,4-d]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dichloro-5,5-dimethyl-7H-thieno[3,4-d]pyridazine (CAS 2893971-20-3) is a chemical compound with the molecular formula C8H8Cl2N2S and a molecular weight of 235.13 g/mol. IUPAC name: 1,4-dichloro-5,5-dimethyl-7H-thieno[3,4-d]pyridazine. InChIKey: LYWUVTBDARYOOP-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2S |
|---|---|
| Molecular weight | 235.13 g/mol |
| IUPAC name | 1,4-dichloro-5,5-dimethyl-7H-thieno[3,4-d]pyridazine |
| InChIKey | LYWUVTBDARYOOP-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CS1)C(=NN=C2Cl)Cl)C |
Computed by PubChem (NCBI)