CAS 1187830-62-1 is the registry number for (4-Chlorothieno[3,2-c]pyridin-2-yl)methanamine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chlorothieno[3,2-c]pyridin-2-yl)methanamine;hydrochloride (CAS 1187830-62-1) is a chemical compound with the molecular formula C8H8Cl2N2S and a molecular weight of 235.13 g/mol. IUPAC name: (4-chlorothieno[3,2-c]pyridin-2-yl)methanamine;hydrochloride. InChIKey: YHZXBFUTRHKDMW-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2S |
|---|---|
| Molecular weight | 235.13 g/mol |
| IUPAC name | (4-chlorothieno[3,2-c]pyridin-2-yl)methanamine;hydrochloride |
| InChIKey | YHZXBFUTRHKDMW-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1SC(=C2)CN)Cl.Cl |
Computed by PubChem (NCBI)