CAS 1052406-44-6 appears in our catalog under these names: ([3-(2-Aminoethyl)-1h-indol-5-yl]oxy)acetic acid hydrochloride, 95%, 5-Carboxymethoxytryptamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg, 50mg.
2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetic acid;hydrochloride (CAS 1052406-44-6) is a chemical compound with the molecular formula C12H15ClN2O3 and a molecular weight of 270.71 g/mol. IUPAC name: 2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetic acid;hydrochloride. InChIKey: WIPHIJQPEMZXMV-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O3 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetic acid;hydrochloride |
| InChIKey | WIPHIJQPEMZXMV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OCC(=O)O)C(=CN2)CCN.Cl |
Computed by PubChem (NCBI)