CAS 1052516-42-3 appears in our catalog under these names: 4-([(2-Pyridinylmethyl)amino]methyl)benzoic acid hydrochloride, 95%, 4-{((2-pyridinylmethyl)amino)methyl}benzoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-[(pyridin-2-ylmethylamino)methyl]benzoic acid;hydrochloride (CAS 1052516-42-3) is a chemical compound with the molecular formula C14H15ClN2O2 and a molecular weight of 278.73 g/mol. IUPAC name: 4-[(pyridin-2-ylmethylamino)methyl]benzoic acid;hydrochloride. InChIKey: IHUOFBMRONPBFE-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O2 |
|---|---|
| Molecular weight | 278.73 g/mol |
| IUPAC name | 4-[(pyridin-2-ylmethylamino)methyl]benzoic acid;hydrochloride |
| InChIKey | IHUOFBMRONPBFE-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNCC2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)