CAS 1638768-95-2 is the registry number for Methyl 1-(5-chloro-1H-pyrrolo[2,3-b]pyridin-1-yl)cyclopentane-1-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-(5-chloropyrrolo[2,3-b]pyridin-1-yl)cyclopentane-1-carboxylate (CAS 1638768-95-2) is a chemical compound with the molecular formula C14H15ClN2O2 and a molecular weight of 278.73 g/mol. IUPAC name: methyl 1-(5-chloropyrrolo[2,3-b]pyridin-1-yl)cyclopentane-1-carboxylate. InChIKey: UMONERPXGDSHFM-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O2 |
|---|---|
| Molecular weight | 278.73 g/mol |
| IUPAC name | methyl 1-(5-chloropyrrolo[2,3-b]pyridin-1-yl)cyclopentane-1-carboxylate |
| InChIKey | UMONERPXGDSHFM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCCC1)N2C=CC3=CC(=CN=C32)Cl |
Computed by PubChem (NCBI)