Products 1415719-04-8
CAS 1415719-04-8 is the registry number for 1-(4-Chlorophenyl)-3-[(cyclopropylmethyl)amino]pyrrolidine-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-(4-chlorophenyl)-3-(cyclopropylmethylamino)pyrrolidine-2,5-dione (CAS 1415719-04-8) is a chemical compound with the molecular formula C14H15ClN2O2 and a molecular weight of 278.73 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-(cyclopropylmethylamino)pyrrolidine-2,5-dione. InChIKey: TVPYRVWWNFLNIB-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O2 |
|---|---|
| Molecular weight | 278.73 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-(cyclopropylmethylamino)pyrrolidine-2,5-dione |
| InChIKey | TVPYRVWWNFLNIB-UHFFFAOYSA-N |
| SMILES | C1CC1CNC2CC(=O)N(C2=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)