CAS 957505-02-1 is the registry number for 3-[(4-Chloro-3,5-dimethyl-1h-pyrazol-1-yl)methyl]-4-methoxybenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxybenzaldehyde (CAS 957505-02-1) is a chemical compound with the molecular formula C14H15ClN2O2 and a molecular weight of 278.73 g/mol. IUPAC name: 3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxybenzaldehyde. InChIKey: QXZWDHGCGQIEGG-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O2 |
|---|---|
| Molecular weight | 278.73 g/mol |
| IUPAC name | 3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxybenzaldehyde |
| InChIKey | QXZWDHGCGQIEGG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=C(C=CC(=C2)C=O)OC)C)Cl |
Computed by PubChem (NCBI)