Products 1052547-97-3
CAS 1052547-97-3 is the registry number for 1-(1-(4-Chlorophenyl)ethyl)-1H-pyrazol-5-amine, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[1-(4-chlorophenyl)ethyl]pyrazol-3-amine (CAS 1052547-97-3) is a chemical compound with the molecular formula C11H12ClN3 and a molecular weight of 221.68 g/mol. IUPAC name: 2-[1-(4-chlorophenyl)ethyl]pyrazol-3-amine. InChIKey: RFIPVJJGXFMAKY-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | 2-[1-(4-chlorophenyl)ethyl]pyrazol-3-amine |
| InChIKey | RFIPVJJGXFMAKY-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Cl)N2C(=CC=N2)N |
Computed by PubChem (NCBI)