Products 1052549-97-9
CAS 1052549-97-9 appears in our catalog under these names: 1-(1-(2,5-Dichlorophenyl)ethyl)-1H-pyrazol-5-amine, 95%, 1-(1-(2,5-Dichlorophenyl)ethyl)-1H-pyrazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-[1-(2,5-dichlorophenyl)ethyl]pyrazol-3-amine (CAS 1052549-97-9) is a chemical compound with the molecular formula C11H11Cl2N3 and a molecular weight of 256.13 g/mol. IUPAC name: 2-[1-(2,5-dichlorophenyl)ethyl]pyrazol-3-amine. InChIKey: UNKGHVUVENUSRZ-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2N3 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 2-[1-(2,5-dichlorophenyl)ethyl]pyrazol-3-amine |
| InChIKey | UNKGHVUVENUSRZ-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1)Cl)Cl)N2C(=CC=N2)N |
Computed by PubChem (NCBI)