CAS 1955554-25-2 appears in our catalog under these names: N5-(4-Chlorophenyl)pyridine-2,5-diamine hydrochloride, 95%, N5-(4-Chlorophenyl)pyridine-2,5-diamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-N-(4-chlorophenyl)pyridine-2,5-diamine;hydrochloride (CAS 1955554-25-2) is a chemical compound with the molecular formula C11H11Cl2N3 and a molecular weight of 256.13 g/mol. IUPAC name: 5-N-(4-chlorophenyl)pyridine-2,5-diamine;hydrochloride. InChIKey: IPAVTCMMMZUUAS-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2N3 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 5-N-(4-chlorophenyl)pyridine-2,5-diamine;hydrochloride |
| InChIKey | IPAVTCMMMZUUAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=CN=C(C=C2)N)Cl.Cl |
Computed by PubChem (NCBI)