CAS 1178648-66-2 is the registry number for N-(3,4-Dichlorobenzyl)-1-methyl-1H-pyrazol-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(3,4-dichlorophenyl)methyl]-1-methylpyrazol-3-amine (CAS 1178648-66-2) is a chemical compound with the molecular formula C11H11Cl2N3 and a molecular weight of 256.13 g/mol. IUPAC name: N-[(3,4-dichlorophenyl)methyl]-1-methylpyrazol-3-amine. InChIKey: UWMKXECXXAXZML-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2N3 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | N-[(3,4-dichlorophenyl)methyl]-1-methylpyrazol-3-amine |
| InChIKey | UWMKXECXXAXZML-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=N1)NCC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)