CAS 1356744-23-4 is the registry number for 2-(3,4-Dichlorophenyl)-4,5-dimethyl-2,3-dihydro-1H-pyrazol-3-imine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3,4-dichlorophenyl)-4,5-dimethylpyrazol-3-amine (CAS 1356744-23-4) is a chemical compound with the molecular formula C11H11Cl2N3 and a molecular weight of 256.13 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-4,5-dimethylpyrazol-3-amine. InChIKey: WGBWFXJNJORWLS-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2N3 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-4,5-dimethylpyrazol-3-amine |
| InChIKey | WGBWFXJNJORWLS-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1C)C2=CC(=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)