CAS 1427501-67-4 appears in our catalog under these names: Ethyl 4,6-difluoropyrazolo(1,5-a)pyridine-3-carboxylate, 97%, Ethyl 4,6-difluoropyrazolo(1,5-a)pyridine-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Ethyl 4,6-difluoropyrazolo[1,5-a]pyridine-3-carboxylate (CAS 1427501-67-4) is a chemical compound with the molecular formula C10H8F2N2O2 and a molecular weight of 226.18 g/mol. IUPAC name: ethyl 4,6-difluoropyrazolo[1,5-a]pyridine-3-carboxylate. InChIKey: MHQFELVZNNGRDV-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2O2 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | ethyl 4,6-difluoropyrazolo[1,5-a]pyridine-3-carboxylate |
| InChIKey | MHQFELVZNNGRDV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C(=CC(=CN2N=C1)F)F |
Computed by PubChem (NCBI)