CAS 1052563-94-6 appears in our catalog under these names: 5-(2,4-Dimethylphenyl)-5-methylimidazolidine-2,4-dione, 95%, 5-(2,4-Dimethylphenyl)-5-methylimidazolidine-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-(2,4-dimethylphenyl)-5-methylimidazolidine-2,4-dione (CAS 1052563-94-6) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 5-(2,4-dimethylphenyl)-5-methylimidazolidine-2,4-dione. InChIKey: YZNZRMCEURBFOR-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 5-(2,4-dimethylphenyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | YZNZRMCEURBFOR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2(C(=O)NC(=O)N2)C)C |
Computed by PubChem (NCBI)