CAS 1052564-95-0 appears in our catalog under these names: 1-{(4-(trifluoromethoxy)phenyl)methyl}-1H-pyrazol-5-amine, 95%, 1-{(4-(Trifluoromethoxy)phenyl)methyl}-1H-pyrazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-[[4-(trifluoromethoxy)phenyl]methyl]pyrazol-3-amine (CAS 1052564-95-0) is a chemical compound with the molecular formula C11H10F3N3O and a molecular weight of 257.21 g/mol. IUPAC name: 2-[[4-(trifluoromethoxy)phenyl]methyl]pyrazol-3-amine. InChIKey: YDKROERRTYCSRC-UHFFFAOYSA-N.
| Molecular formula | C11H10F3N3O |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | 2-[[4-(trifluoromethoxy)phenyl]methyl]pyrazol-3-amine |
| InChIKey | YDKROERRTYCSRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C(=CC=N2)N)OC(F)(F)F |
Computed by PubChem (NCBI)