CAS 1152841-84-3 is the registry number for 1-(4-(Trifluoromethoxy)benzyl)-1H-pyrazol-4-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[[4-(trifluoromethoxy)phenyl]methyl]pyrazol-4-amine (CAS 1152841-84-3) is a chemical compound with the molecular formula C11H10F3N3O and a molecular weight of 257.21 g/mol. IUPAC name: 1-[[4-(trifluoromethoxy)phenyl]methyl]pyrazol-4-amine. InChIKey: ZSWQEGDFUDMPAP-UHFFFAOYSA-N.
| Molecular formula | C11H10F3N3O |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | 1-[[4-(trifluoromethoxy)phenyl]methyl]pyrazol-4-amine |
| InChIKey | ZSWQEGDFUDMPAP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(C=N2)N)OC(F)(F)F |
Computed by PubChem (NCBI)