Products 1183457-90-0
CAS 1183457-90-0 appears in our catalog under these names: 1-(4-(Trifluoromethoxy)benzyl)-1H-pyrazol-3-amine, 97%, 97%, 1-{[4-(trifluoromethoxy)phenyl]methyl}-1H-pyrazol-3-amine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-[[4-(trifluoromethoxy)phenyl]methyl]pyrazol-3-amine (CAS 1183457-90-0) is a chemical compound with the molecular formula C11H10F3N3O and a molecular weight of 257.21 g/mol. IUPAC name: 1-[[4-(trifluoromethoxy)phenyl]methyl]pyrazol-3-amine. InChIKey: SIKIKHWVJZISFJ-UHFFFAOYSA-N.
| Molecular formula | C11H10F3N3O |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | 1-[[4-(trifluoromethoxy)phenyl]methyl]pyrazol-3-amine |
| InChIKey | SIKIKHWVJZISFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=CC(=N2)N)OC(F)(F)F |
Computed by PubChem (NCBI)