CAS 1259056-49-9 is the registry number for 3-Methyl-N-(3-(trifluoromethyl)benzyl)-1,2,4-oxadiazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-amine (CAS 1259056-49-9) is a chemical compound with the molecular formula C11H10F3N3O and a molecular weight of 257.21 g/mol. IUPAC name: 3-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-amine. InChIKey: UFNWQHFEDYSAHC-UHFFFAOYSA-N.
| Molecular formula | C11H10F3N3O |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | 3-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4-oxadiazol-5-amine |
| InChIKey | UFNWQHFEDYSAHC-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)NCC2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)