CAS 1052617-38-5 appears in our catalog under these names: 3-(Difluoromethyl)-1-methyl-1h-pyrazole-5-carboxylic acid, 97%, 3-(Difluoromethyl)-1-methyl-1H-pyrazole-5-carboxylic acid 97%, 3-(Difluoromethyl)-1-methyl-1H-pyrazole-5-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
3-(difluoromethyl)-1-methylpyrazole-5-carboxylic acid (CAS 1052617-38-5) is a chemical compound with the molecular formula C6H6F2N2O2 and a molecular weight of 176.12 g/mol. IUPAC name: 3-(difluoromethyl)-1-methylpyrazole-5-carboxylic acid. InChIKey: AAHYTWRSQZFZCM-UHFFFAOYSA-N.
| Molecular formula | C6H6F2N2O2 |
|---|---|
| Molecular weight | 176.12 g/mol |
| IUPAC name | 3-(difluoromethyl)-1-methylpyrazole-5-carboxylic acid |
| InChIKey | AAHYTWRSQZFZCM-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(F)F)C(=O)O |
Computed by PubChem (NCBI)