CAS 176969-34-9 appears in our catalog under these names: 3-Difluoromethyl-1-methylpyrazole-4-carboxylic Acid, 3-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic Acid, >95% (HPLC), Fluxapyroxad metabolite M700F001, 3–(Difluoromethyl)–1–methyl–1H–pyrazole–4–carboxylic acid, 3-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Biosynth, Ambeed. Available pack sizes: 50mg, 100mg, 500mg, 100g, 500g, 250g, 250mg, 1g.
3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid (CAS 176969-34-9) is a chemical compound with the molecular formula C6H6F2N2O2 and a molecular weight of 176.12 g/mol. IUPAC name: 3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid. InChIKey: RLOHOBNEYHBZID-UHFFFAOYSA-N.
| Molecular formula | C6H6F2N2O2 |
|---|---|
| Molecular weight | 176.12 g/mol |
| IUPAC name | 3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid |
| InChIKey | RLOHOBNEYHBZID-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(F)F)C(=O)O |
Computed by PubChem (NCBI)