CAS 1204298-65-6 appears in our catalog under these names: 5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid, 98%, 5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic Acid, 5–(Difluoromethyl)–1–methyl–1H–pyrazole–4–carboxylic acid, 5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 200mg, 10g.
5-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid (CAS 1204298-65-6) is a chemical compound with the molecular formula C6H6F2N2O2 and a molecular weight of 176.12 g/mol. IUPAC name: 5-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid. InChIKey: CTTXMUZEFPPHGD-UHFFFAOYSA-N.
| Molecular formula | C6H6F2N2O2 |
|---|---|
| Molecular weight | 176.12 g/mol |
| IUPAC name | 5-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid |
| InChIKey | CTTXMUZEFPPHGD-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C(=O)O)C(F)F |
Computed by PubChem (NCBI)