Products 1174308-83-8
CAS 1174308-83-8 appears in our catalog under these names: 5-(Difluoromethyl)-1-methyl-1h-pyrazole-3-carboxylic acid, 95%, 5-(Difluoromethyl)-1-methyl-1H-pyrazole-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-(difluoromethyl)-1-methylpyrazole-3-carboxylic acid (CAS 1174308-83-8) is a chemical compound with the molecular formula C6H6F2N2O2 and a molecular weight of 176.12 g/mol. IUPAC name: 5-(difluoromethyl)-1-methylpyrazole-3-carboxylic acid. InChIKey: XJZOYEUCGIXABG-UHFFFAOYSA-N.
| Molecular formula | C6H6F2N2O2 |
|---|---|
| Molecular weight | 176.12 g/mol |
| IUPAC name | 5-(difluoromethyl)-1-methylpyrazole-3-carboxylic acid |
| InChIKey | XJZOYEUCGIXABG-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)O)C(F)F |
Computed by PubChem (NCBI)