Products 1052714-87-0
CAS 1052714-87-0 is the registry number for Methyl 3-amino-6-(2,6-difluorophenyl)picolinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-amino-6-(2,6-difluorophenyl)pyridine-2-carboxylate (CAS 1052714-87-0) is a chemical compound with the molecular formula C13H10F2N2O2 and a molecular weight of 264.23 g/mol. IUPAC name: methyl 3-amino-6-(2,6-difluorophenyl)pyridine-2-carboxylate. InChIKey: LRUILNIGBADSHR-UHFFFAOYSA-N.
| Molecular formula | C13H10F2N2O2 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | methyl 3-amino-6-(2,6-difluorophenyl)pyridine-2-carboxylate |
| InChIKey | LRUILNIGBADSHR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=N1)C2=C(C=CC=C2F)F)N |
Computed by PubChem (NCBI)