Products 477872-05-2
CAS 477872-05-2 is the registry number for N-(2,4-Difluorophenyl)-2-(1-methyl-1h-pyrrol-2-yl)-2-oxoacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-(2,4-difluorophenyl)-2-(1-methylpyrrol-2-yl)-2-oxoacetamide (CAS 477872-05-2) is a chemical compound with the molecular formula C13H10F2N2O2 and a molecular weight of 264.23 g/mol. IUPAC name: N-(2,4-difluorophenyl)-2-(1-methylpyrrol-2-yl)-2-oxoacetamide. InChIKey: WIMBCAREQVSSHZ-UHFFFAOYSA-N.
| Molecular formula | C13H10F2N2O2 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | N-(2,4-difluorophenyl)-2-(1-methylpyrrol-2-yl)-2-oxoacetamide |
| InChIKey | WIMBCAREQVSSHZ-UHFFFAOYSA-N |
| SMILES | CN1C=CC=C1C(=O)C(=O)NC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)