CAS 1283628-49-8 is the registry number for 1-(2,3-Difluorophenyl)-1H,4H,5H,6H-cyclopenta(C)pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,3-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid (CAS 1283628-49-8) is a chemical compound with the molecular formula C13H10F2N2O2 and a molecular weight of 264.23 g/mol. IUPAC name: 1-(2,3-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid. InChIKey: JAMZXKPUSRETHC-UHFFFAOYSA-N.
| Molecular formula | C13H10F2N2O2 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | 1-(2,3-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid |
| InChIKey | JAMZXKPUSRETHC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N(N=C2C(=O)O)C3=C(C(=CC=C3)F)F |
Computed by PubChem (NCBI)