CAS 926265-67-0 appears in our catalog under these names: 1-(2,4-Difluorophenyl)-1H,4H,5H,6H-cyclopenta(c)pyrazole-3-carboxylic acid, 95%, 1-(2,4-Difluorophenyl)-1H,4H,5H,6H-cyclopenta(C)pyrazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-(2,4-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid (CAS 926265-67-0) is a chemical compound with the molecular formula C13H10F2N2O2 and a molecular weight of 264.23 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid. InChIKey: DYCJIRSLFSRNQA-UHFFFAOYSA-N.
| Molecular formula | C13H10F2N2O2 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid |
| InChIKey | DYCJIRSLFSRNQA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N(N=C2C(=O)O)C3=C(C=C(C=C3)F)F |
Computed by PubChem (NCBI)