Products 1052737-14-0

CAS 1052737-14-0 is the registry number for 5-(Prop-2-yn-1-yloxy)isophthalic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-prop-2-ynoxybenzene-1,3-dicarboxylic acid (CAS 1052737-14-0) is a chemical compound with the molecular formula C11H8O5 and a molecular weight of 220.18 g/mol. IUPAC name: 5-prop-2-ynoxybenzene-1,3-dicarboxylic acid. InChIKey: WUNOOPQHQITNBR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8O5
Molecular weight220.18 g/mol
IUPAC name5-prop-2-ynoxybenzene-1,3-dicarboxylic acid
InChIKeyWUNOOPQHQITNBR-UHFFFAOYSA-N
SMILESC#CCOC1=CC(=CC(=C1)C(=O)O)C(=O)O

Computed by PubChem (NCBI)