Products 76743-83-4

CAS 76743-83-4 is the registry number for 5-Methoxy-4-oxo-4H-chromene-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methoxy-4-oxochromene-3-carboxylic acid (CAS 76743-83-4) is a chemical compound with the molecular formula C11H8O5 and a molecular weight of 220.18 g/mol. IUPAC name: 5-methoxy-4-oxochromene-3-carboxylic acid. InChIKey: PVOXLQUTKOGCOE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8O5
Molecular weight220.18 g/mol
IUPAC name5-methoxy-4-oxochromene-3-carboxylic acid
InChIKeyPVOXLQUTKOGCOE-UHFFFAOYSA-N
SMILESCOC1=CC=CC2=C1C(=O)C(=CO2)C(=O)O

Computed by PubChem (NCBI)