CAS 181022-09-3 appears in our catalog under these names: 2-(Prop-2-yn-1-yloxy)terephthalic acid, 95%, 2-(2-Propyn-1-yloxy)-1,4-benzenedicarboxylic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
2-prop-2-ynoxyterephthalic acid (CAS 181022-09-3) is a chemical compound with the molecular formula C11H8O5 and a molecular weight of 220.18 g/mol. IUPAC name: 2-prop-2-ynoxyterephthalic acid. InChIKey: DPTAKLOJZFUBKO-UHFFFAOYSA-N.
| Molecular formula | C11H8O5 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 2-prop-2-ynoxyterephthalic acid |
| InChIKey | DPTAKLOJZFUBKO-UHFFFAOYSA-N |
| SMILES | C#CCOC1=C(C=CC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)