Products 1093228-16-0

CAS 1093228-16-0 is the registry number for Dioncoquinone B. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

4,7,8-trihydroxy-3-methylnaphthalene-1,2-dione (CAS 1093228-16-0) is a chemical compound with the molecular formula C11H8O5 and a molecular weight of 220.18 g/mol. IUPAC name: 4,7,8-trihydroxy-3-methylnaphthalene-1,2-dione. InChIKey: NKWUAYRVOYZNJX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8O5
Molecular weight220.18 g/mol
IUPAC name4,7,8-trihydroxy-3-methylnaphthalene-1,2-dione
InChIKeyNKWUAYRVOYZNJX-UHFFFAOYSA-N
SMILESCC1=C(C2=C(C(=C(C=C2)O)O)C(=O)C1=O)O

Computed by PubChem (NCBI)