CAS 105276-96-8 appears in our catalog under these names: 5-bromo-1,2-dihydro-1,6-naphthyridin-2-one, 96%, 5-Bromo-1,6-naphthyridin-2(1H)-one, 96%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-bromo-1H-1,6-naphthyridin-2-one (CAS 105276-96-8) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 5-bromo-1H-1,6-naphthyridin-2-one. InChIKey: HBOWEWFBGYLXNY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 5-bromo-1H-1,6-naphthyridin-2-one |
| InChIKey | HBOWEWFBGYLXNY-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=C1C(=NC=C2)Br |
Computed by PubChem (NCBI)