CAS 10529-35-8 is the registry number for 2-Methylquinoline-7,8-diol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylquinoline-7,8-diol (CAS 10529-35-8) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 2-methylquinoline-7,8-diol. InChIKey: GVLHNBUPNCIILV-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 2-methylquinoline-7,8-diol |
| InChIKey | GVLHNBUPNCIILV-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC(=C2O)O |
Computed by PubChem (NCBI)