CAS 105300-90-1 appears in our catalog under these names: 4-(Boc-4-aminophenyl)-butanoic acid, 95%, 4–(4–((tert–Butoxycarbonyl)amino)phenyl)butanoic acid, 4-(Boc-4-aminophenyl)butanoic acid, 4-(BOC-4-AMINOPHENYL)-BUTANOIC ACID, 95%, 95%, 4-(4-((tert-Butoxycarbonyl)amino)phenyl)butanoic acid. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 100mg, Get quote.
4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butanoic acid (CAS 105300-90-1) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: 4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butanoic acid. InChIKey: JVKQXXXBFHIZTQ-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | 4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]butanoic acid |
| InChIKey | JVKQXXXBFHIZTQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)CCCC(=O)O |
Computed by PubChem (NCBI)