CAS 105442-23-7 is the registry number for 3-Chloro-4-(methylthio)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
Methyl 3-chloro-4-methylsulfanylbenzoate (CAS 105442-23-7) is a chemical compound with the molecular formula C9H9ClO2S and a molecular weight of 216.68 g/mol. IUPAC name: methyl 3-chloro-4-methylsulfanylbenzoate. InChIKey: RKEOCHLSEHNYMF-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2S |
|---|---|
| Molecular weight | 216.68 g/mol |
| IUPAC name | methyl 3-chloro-4-methylsulfanylbenzoate |
| InChIKey | RKEOCHLSEHNYMF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)SC)Cl |
Computed by PubChem (NCBI)