CAS 958651-12-2 appears in our catalog under these names: 3-cyclopropylbenzene-1-sulfonyl chloride, 95%, 3-Cyclopropyl-benzenesulfonyl chloride, 95%, 3-cyclopropylbenzene-1-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 0,5g, 0,25g, 2g.
3-cyclopropylbenzenesulfonyl chloride (CAS 958651-12-2) is a chemical compound with the molecular formula C9H9ClO2S and a molecular weight of 216.68 g/mol. IUPAC name: 3-cyclopropylbenzenesulfonyl chloride. InChIKey: SOBFLTOURJYMBV-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2S |
|---|---|
| Molecular weight | 216.68 g/mol |
| IUPAC name | 3-cyclopropylbenzenesulfonyl chloride |
| InChIKey | SOBFLTOURJYMBV-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)