CAS 98821-28-4 appears in our catalog under these names: (E)-2-(4-Methylphenyl)ethene-1-sulfonyl chloride, (E)-2-(4-Methylphenyl)ethene-1-sulfonyl chloride, 95%, (E)-2-(p-Tolyl)ethenesulfonyl chloride, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 50mg, 0,5g, 5g, 10g, 250mg, 1g.
(E)-2-(4-methylphenyl)ethenesulfonyl chloride (CAS 98821-28-4) is a chemical compound with the molecular formula C9H9ClO2S and a molecular weight of 216.68 g/mol. IUPAC name: (E)-2-(4-methylphenyl)ethenesulfonyl chloride. InChIKey: MRZCTZARTQWKLE-VOTSOKGWSA-N.
| Molecular formula | C9H9ClO2S |
|---|---|
| Molecular weight | 216.68 g/mol |
| IUPAC name | (E)-2-(4-methylphenyl)ethenesulfonyl chloride |
| InChIKey | MRZCTZARTQWKLE-VOTSOKGWSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C/S(=O)(=O)Cl |
Computed by PubChem (NCBI)