CAS 1359655-41-6 appears in our catalog under these names: 1-Phenylcyclopropane-1-sulfonyl chloride, 95%, 1-Phenylcyclopropanesulfonyl Chloride, 1-Phenylcyclopropane-1-sulfonyl chloride, 97%, 1-Phenylcyclopropane-1-sulfonyl chloride, 97%, 97%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 5g, 0,5g, 50mg, 100mg, 250mg, 500mg.
1-phenylcyclopropane-1-sulfonyl chloride (CAS 1359655-41-6) is a chemical compound with the molecular formula C9H9ClO2S and a molecular weight of 216.68 g/mol. IUPAC name: 1-phenylcyclopropane-1-sulfonyl chloride. InChIKey: LYYCQAQCTDHPOK-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2S |
|---|---|
| Molecular weight | 216.68 g/mol |
| IUPAC name | 1-phenylcyclopropane-1-sulfonyl chloride |
| InChIKey | LYYCQAQCTDHPOK-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)