CAS 105459-30-1 appears in our catalog under these names: 2-Bromo-5-ethylbenzoic acid, 95%, 2-Bromo-5-ethylbenzoic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
2-bromo-5-ethylbenzoic acid (CAS 105459-30-1) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 2-bromo-5-ethylbenzoic acid. InChIKey: APZKAKQIWDKNNH-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 2-bromo-5-ethylbenzoic acid |
| InChIKey | APZKAKQIWDKNNH-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)