Products 10551-21-0

CAS 10551-21-0 is the registry number for 1-Phenethyl-2-picolinium bromide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g.

Structural formula: {0} (CAS {1})

2-methyl-1-(2-phenylethyl)pyridin-1-ium bromide (CAS 10551-21-0) is a chemical compound with the molecular formula C14H16BrN and a molecular weight of 278.19 g/mol. IUPAC name: 2-methyl-1-(2-phenylethyl)pyridin-1-ium bromide. InChIKey: AYHBRSKXFVQPPX-UHFFFAOYSA-M.

Identity
Molecular formulaC14H16BrN
Molecular weight278.19 g/mol
IUPAC name2-methyl-1-(2-phenylethyl)pyridin-1-ium bromide
InChIKeyAYHBRSKXFVQPPX-UHFFFAOYSA-M
SMILESCC1=CC=CC=[N+]1CCC2=CC=CC=C2.[Br-]

Computed by PubChem (NCBI)