CAS 10551-21-0 is the registry number for 1-Phenethyl-2-picolinium bromide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g.
2-methyl-1-(2-phenylethyl)pyridin-1-ium bromide (CAS 10551-21-0) is a chemical compound with the molecular formula C14H16BrN and a molecular weight of 278.19 g/mol. IUPAC name: 2-methyl-1-(2-phenylethyl)pyridin-1-ium bromide. InChIKey: AYHBRSKXFVQPPX-UHFFFAOYSA-M.
| Molecular formula | C14H16BrN |
|---|---|
| Molecular weight | 278.19 g/mol |
| IUPAC name | 2-methyl-1-(2-phenylethyl)pyridin-1-ium bromide |
| InChIKey | AYHBRSKXFVQPPX-UHFFFAOYSA-M |
| SMILES | CC1=CC=CC=[N+]1CCC2=CC=CC=C2.[Br-] |
Computed by PubChem (NCBI)