CAS 1427378-93-5 appears in our catalog under these names: 6-Bromo-3,3-dimethyl-2,3,4,9-tetrahydro-1H-carbazole, 95%, 6-Bromo-3,3-dimethyl-2,3,4,9-tetrahydro-1H-carbazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
6-bromo-3,3-dimethyl-1,2,4,9-tetrahydrocarbazole (CAS 1427378-93-5) is a chemical compound with the molecular formula C14H16BrN and a molecular weight of 278.19 g/mol. IUPAC name: 6-bromo-3,3-dimethyl-1,2,4,9-tetrahydrocarbazole. InChIKey: DRDOXCHFYRVURO-UHFFFAOYSA-N.
| Molecular formula | C14H16BrN |
|---|---|
| Molecular weight | 278.19 g/mol |
| IUPAC name | 6-bromo-3,3-dimethyl-1,2,4,9-tetrahydrocarbazole |
| InChIKey | DRDOXCHFYRVURO-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1)C3=C(N2)C=CC(=C3)Br)C |
Computed by PubChem (NCBI)