Products 76618-92-3
CAS 76618-92-3 is the registry number for 2-(4-Bromophenyl)-2-cyclohexylacetonitrile 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(4-bromophenyl)-2-cyclohexylacetonitrile (CAS 76618-92-3) is a chemical compound with the molecular formula C14H16BrN and a molecular weight of 278.19 g/mol. IUPAC name: 2-(4-bromophenyl)-2-cyclohexylacetonitrile. InChIKey: ODFXUAQGVHNEEP-UHFFFAOYSA-N.
| Molecular formula | C14H16BrN |
|---|---|
| Molecular weight | 278.19 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-cyclohexylacetonitrile |
| InChIKey | ODFXUAQGVHNEEP-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C#N)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)