CAS 646038-03-1 appears in our catalog under these names: 2-Bromo-5H,6H,7H,8H,9H,10H,11H-cycloocta(b)indole, 95%, 2-Bromo-5H,6H,7H,8H,9H,10H,11H-cycloocta(b)indole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-bromo-6,7,8,9,10,11-hexahydro-5H-cycloocta[b]indole (CAS 646038-03-1) is a chemical compound with the molecular formula C14H16BrN and a molecular weight of 278.19 g/mol. IUPAC name: 2-bromo-6,7,8,9,10,11-hexahydro-5H-cycloocta[b]indole. InChIKey: RUKJUCNUNAMZLR-UHFFFAOYSA-N.
| Molecular formula | C14H16BrN |
|---|---|
| Molecular weight | 278.19 g/mol |
| IUPAC name | 2-bromo-6,7,8,9,10,11-hexahydro-5H-cycloocta[b]indole |
| InChIKey | RUKJUCNUNAMZLR-UHFFFAOYSA-N |
| SMILES | C1CCCC2=C(CC1)C3=C(N2)C=CC(=C3)Br |
Computed by PubChem (NCBI)